C13H23N5S — CID 65250704
2,2-dimethyl-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]butanimidamide (PubChem CID 65250704) has the molecular formula C13H23N5S and a molecular weight of 281.43 g/mol. Its IUPAC name is 2,2-dimethyl-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]butanimidamide.
| Compound Name | 2,2-dimethyl-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]butanimidamide |
|---|---|
| PubChem CID | 65250704 |
| Molecular Formula | C13H23N5S |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 2,2-dimethyl-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]butanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCN1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C13H23N5S/c1-13(2,11(14)15)3-5-17-6-8-18(9-7-17)12-16-4-10-19-12/h4,10H,3,5-9H2,1-2H3,(H3,14,15) |
| InChIKey | WUDWTGGXKFLAAE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 69.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|