C19H17N3O4 — CID 652601
N-[5-[(3-methoxybenzoyl)amino]-4-methyl-2-pyridinyl]furan-2-carboxamide (PubChem CID 652601) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is N-[5-[(3-methoxybenzoyl)amino]-4-methyl-2-pyridinyl]furan-2-carboxamide.
| Compound Name | N-[5-[(3-methoxybenzoyl)amino]-4-methyl-2-pyridinyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 652601 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-[5-[(3-methoxybenzoyl)amino]-4-methyl-2-pyridinyl]furan-2-carboxamide |
| SMILES | COc1cccc(C(=O)Nc2cnc(NC(=O)c3ccco3)cc2C)c1 |
| InChI | InChI=1S/C19H17N3O4/c1-12-9-17(22-19(24)16-7-4-8-26-16)20-11-15(12)21-18(23)13-5-3-6-14(10-13)25-2/h3-11H,1-2H3,(H,21,23)(H,20,22,24) |
| InChIKey | GMTPMWAJEDDKFE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |