C9H16N2O5 — CID 65263773
2-[[2-(ethoxycarbonylamino)-2-oxoethyl]amino]-2-methylpropanoic acid (PubChem CID 65263773) has the molecular formula C9H16N2O5 and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-[[2-(ethoxycarbonylamino)-2-oxoethyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[[2-(ethoxycarbonylamino)-2-oxoethyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 65263773 |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2-[[2-(ethoxycarbonylamino)-2-oxoethyl]amino]-2-methylpropanoic acid |
| SMILES | CCOC(=O)NC(=O)CNC(C)(C)C(=O)O |
| InChI | InChI=1S/C9H16N2O5/c1-4-16-8(15)11-6(12)5-10-9(2,3)7(13)14/h10H,4-5H2,1-3H3,(H,13,14)(H,11,12,15) |
| InChIKey | IJQSLXFXFHUPGT-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |