C9H6BrN3O2S — CID 65270789
3-bromo-4-(1,2,4-thiadiazol-5-ylamino)benzoic acid (PubChem CID 65270789) has the molecular formula C9H6BrN3O2S and a molecular weight of 300.14 g/mol. Its IUPAC name is 3-bromo-4-(1,2,4-thiadiazol-5-ylamino)benzoic acid.
| Compound Name | 3-bromo-4-(1,2,4-thiadiazol-5-ylamino)benzoic acid |
|---|---|
| PubChem CID | 65270789 |
| Molecular Formula | C9H6BrN3O2S |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 298.94 |
| IUPAC Name | 3-bromo-4-(1,2,4-thiadiazol-5-ylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2ncns2)c(Br)c1 |
| InChI | InChI=1S/C9H6BrN3O2S/c10-6-3-5(8(14)15)1-2-7(6)13-9-11-4-12-16-9/h1-4H,(H,14,15)(H,11,12,13) |
| InChIKey | QGGGXPHVURSQPR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |