C10H8BrN3O2S — CID 65268301
3-bromo-4-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]benzoic acid (PubChem CID 65268301) has the molecular formula C10H8BrN3O2S and a molecular weight of 314.16 g/mol. Its IUPAC name is 3-bromo-4-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]benzoic acid.
| Compound Name | 3-bromo-4-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 65268301 |
| Molecular Formula | C10H8BrN3O2S |
| Molecular Weight | 314.16 g/mol |
| Exact Mass | 312.95 |
| IUPAC Name | 3-bromo-4-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]benzoic acid |
| SMILES | Cc1nsc(Nc2ccc(C(=O)O)cc2Br)n1 |
| InChI | InChI=1S/C10H8BrN3O2S/c1-5-12-10(17-14-5)13-8-3-2-6(9(15)16)4-7(8)11/h2-4H,1H3,(H,15,16)(H,12,13,14) |
| InChIKey | ZSUDWRFCLGSHGG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.16 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |