C15H22N4S — CID 65270963
N'-methyl-N'-phenyl-N-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)propane-1,3-diamine (PubChem CID 65270963) has the molecular formula C15H22N4S and a molecular weight of 290.44 g/mol. Its IUPAC name is N'-methyl-N'-phenyl-N-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)propane-1,3-diamine.
| Compound Name | N'-methyl-N'-phenyl-N-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 65270963 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N'-methyl-N'-phenyl-N-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)propane-1,3-diamine |
| SMILES | CC(C)c1nsc(NCCCN(C)c2ccccc2)n1 |
| InChI | InChI=1S/C15H22N4S/c1-12(2)14-17-15(20-18-14)16-10-7-11-19(3)13-8-5-4-6-9-13/h4-6,8-9,12H,7,10-11H2,1-3H3,(H,16,17,18) |
| InChIKey | IKYXQIZTYRYEMK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|