C12H24N4OS — CID 114268243
N',N'-diethyl-N-[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]propane-1,3-diamine (PubChem CID 114268243) has the molecular formula C12H24N4OS and a molecular weight of 272.42 g/mol. Its IUPAC name is N',N'-diethyl-N-[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 114268243 |
| Molecular Formula | C12H24N4OS |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | N',N'-diethyl-N-[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(C(C)OC)ns1 |
| InChI | InChI=1S/C12H24N4OS/c1-5-16(6-2)9-7-8-13-12-14-11(15-18-12)10(3)17-4/h10H,5-9H2,1-4H3,(H,13,14,15) |
| InChIKey | RWDKTMWBMFAXJF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|