About 2-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-3-methylbutanamide
2-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-3-methylbutanamide (PubChem CID 114268329) has the molecular formula C10H18N4O2S
and a molecular weight of 258.35 g/mol. Its IUPAC name is 2-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-3-methylbutanamide.
Molecular Properties
| Compound Name | 2-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-3-methylbutanamide |
| PubChem CID | 114268329 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-3-methylbutanamide |
| SMILES | COC(C)c1nsc(NC(C(N)=O)C(C)C)n1 |
| InChI | InChI=1S/C10H18N4O2S/c1-5(2)7(8(11)15)12-10-13-9(14-17-10)6(3)16-4/h5-7H,1-4H3,(H2,11,15)(H,12,13,14) |
| InChIKey | VFGWPXGDBMHRJR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-3-methylbutanamide?
The IUPAC name of 2-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-3-methylbutanamide (CID 114268329) is 2-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-3-methylbutanamide.
What is the SMILES notation for 2-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-3-methylbutanamide?
The canonical SMILES for 2-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-3-methylbutanamide is COC(C)c1nsc(NC(C(N)=O)C(C)C)n1.
What is the InChIKey of 2-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-3-methylbutanamide?
The InChIKey is VFGWPXGDBMHRJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O2S/c1-5(2)7(8(11)15)12-10-13-9(14-17-10)6(3)16-4/h5-7H,1-4H3,(H2,11,15)(H,12,13,14).
What are the key properties of 2-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-3-methylbutanamide?
2-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-3-methylbutanamide has a molecular weight of 258.35 g/mol, XLogP of 1.17, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]amino]-3-methylbutanamide is sourced from PubChem (CID 114268329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).