C16H22N4S — CID 65273828
N-(1-benzylpiperidin-3-yl)-3-ethyl-1,2,4-thiadiazol-5-amine (PubChem CID 65273828) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is N-(1-benzylpiperidin-3-yl)-3-ethyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(1-benzylpiperidin-3-yl)-3-ethyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65273828 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-(1-benzylpiperidin-3-yl)-3-ethyl-1,2,4-thiadiazol-5-amine |
| SMILES | CCc1nsc(NC2CCCN(Cc3ccccc3)C2)n1 |
| InChI | InChI=1S/C16H22N4S/c1-2-15-18-16(21-19-15)17-14-9-6-10-20(12-14)11-13-7-4-3-5-8-13/h3-5,7-8,14H,2,6,9-12H2,1H3,(H,17,18,19) |
| InChIKey | PBYOCEUEBXBCHA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |