C36H36N6O6 — CID 6529104
N-[(Z)-3-[(2Z)-2-[[4-methoxy-3-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]phenyl]methylidene]hydrazinyl]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 6529104) has the molecular formula C36H36N6O6 and a molecular weight of 648.72 g/mol. Its IUPAC name is N-[(Z)-3-[(2Z)-2-[[4-methoxy-3-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]phenyl]methylidene]hydrazinyl]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[(2Z)-2-[[4-methoxy-3-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]phenyl]methylidene]hydrazinyl]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 6529104 |
| Molecular Formula | C36H36N6O6 |
| Molecular Weight | 648.72 g/mol |
| Exact Mass | 648.27 |
| IUPAC Name | N-[(Z)-3-[(2Z)-2-[[4-methoxy-3-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]phenyl]methylidene]hydrazinyl]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)N/N=C\c2ccc(OC)c(CN3CCN(c4ccc([N+](=O)[O-])cc4)CC3)c2)cc1 |
| InChI | InChI=1S/C36H36N6O6/c1-47-32-15-8-26(9-16-32)23-33(38-35(43)28-6-4-3-5-7-28)36(44)39-37-24-27-10-17-34(48-2)29(22-27)25-40-18-20-41(21-19-40)30-11-13-31(14-12-30)42(45)46/h3-17,22-24H,18-21,25H2,1-2H3,(H,38,43)(H,39,44)/b33-23-,37-24- |
| InChIKey | JXWRFVFACCSJJY-ROSJUQAVSA-N |
| XLogP | 4.86 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.72 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|