C11H19N3O3 — CID 65301828
4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(methylamino)butanamide (PubChem CID 65301828) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(methylamino)butanamide.
| Compound Name | 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(methylamino)butanamide |
|---|---|
| PubChem CID | 65301828 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(methylamino)butanamide |
| SMILES | CNC(CCN1C(=O)CC(C)(C)C1=O)C(N)=O |
| InChI | InChI=1S/C11H19N3O3/c1-11(2)6-8(15)14(10(11)17)5-4-7(13-3)9(12)16/h7,13H,4-6H2,1-3H3,(H2,12,16) |
| InChIKey | KYYPKTMTXKFYMJ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|