C14H13BCl2O3 — CID 65316782
[2-[(2,5-dichlorophenyl)methoxy]-5-methylphenyl]boronic acid (PubChem CID 65316782) has the molecular formula C14H13BCl2O3 and a molecular weight of 310.97 g/mol. Its IUPAC name is [2-[(2,5-dichlorophenyl)methoxy]-5-methylphenyl]boronic acid.
| Compound Name | [2-[(2,5-dichlorophenyl)methoxy]-5-methylphenyl]boronic acid |
|---|---|
| PubChem CID | 65316782 |
| Molecular Formula | C14H13BCl2O3 |
| Molecular Weight | 310.97 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | [2-[(2,5-dichlorophenyl)methoxy]-5-methylphenyl]boronic acid |
| SMILES | Cc1ccc(OCc2cc(Cl)ccc2Cl)c(B(O)O)c1 |
| InChI | InChI=1S/C14H13BCl2O3/c1-9-2-5-14(12(6-9)15(18)19)20-8-10-7-11(16)3-4-13(10)17/h2-7,18-19H,8H2,1H3 |
| InChIKey | VMCQYEHOGWNPMT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.97 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|