C21H24N2O6S — CID 6532798
diethyl 2-[[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]methylidene]propanedioate (PubChem CID 6532798) has the molecular formula C21H24N2O6S and a molecular weight of 432.50 g/mol. Its IUPAC name is diethyl 2-[[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]methylidene]propanedioate |
|---|---|
| PubChem CID | 6532798 |
| Molecular Formula | C21H24N2O6S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | diethyl 2-[[2-[(5Z)-5-[(4-methylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethylamino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNCCN1C(=O)S/C(=C\c2ccc(C)cc2)C1=O)C(=O)OCC |
| InChI | InChI=1S/C21H24N2O6S/c1-4-28-19(25)16(20(26)29-5-2)13-22-10-11-23-18(24)17(30-21(23)27)12-15-8-6-14(3)7-9-15/h6-9,12-13,22H,4-5,10-11H2,1-3H3/b17-12- |
| InChIKey | AIZMUXBHNMHFIZ-ATVHPVEESA-N |
| XLogP | 2.63 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|