About N-([1,3]thiazolo[5,4-b]pyridin-2-ylmethyl)cyclopentanamine
N-([1,3]thiazolo[5,4-b]pyridin-2-ylmethyl)cyclopentanamine (PubChem CID 65336897) has the molecular formula C12H15N3S
and a molecular weight of 233.34 g/mol. Its IUPAC name is N-([1,3]thiazolo[5,4-b]pyridin-2-ylmethyl)cyclopentanamine.
Molecular Properties
| Compound Name | N-([1,3]thiazolo[5,4-b]pyridin-2-ylmethyl)cyclopentanamine |
| PubChem CID | 65336897 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | N-([1,3]thiazolo[5,4-b]pyridin-2-ylmethyl)cyclopentanamine |
| SMILES | c1cnc2sc(CNC3CCCC3)nc2c1 |
| InChI | InChI=1S/C12H15N3S/c1-2-5-9(4-1)14-8-11-15-10-6-3-7-13-12(10)16-11/h3,6-7,9,14H,1-2,4-5,8H2 |
| InChIKey | DXADSKSFQHIMNC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-([1,3]thiazolo[5,4-b]pyridin-2-ylmethyl)cyclopentanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-([1,3]thiazolo[5,4-b]pyridin-2-ylmethyl)cyclopentanamine?
The IUPAC name of N-([1,3]thiazolo[5,4-b]pyridin-2-ylmethyl)cyclopentanamine (CID 65336897) is N-([1,3]thiazolo[5,4-b]pyridin-2-ylmethyl)cyclopentanamine.
What is the SMILES notation for N-([1,3]thiazolo[5,4-b]pyridin-2-ylmethyl)cyclopentanamine?
The canonical SMILES for N-([1,3]thiazolo[5,4-b]pyridin-2-ylmethyl)cyclopentanamine is c1cnc2sc(CNC3CCCC3)nc2c1.
What is the InChIKey of N-([1,3]thiazolo[5,4-b]pyridin-2-ylmethyl)cyclopentanamine?
The InChIKey is DXADSKSFQHIMNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3S/c1-2-5-9(4-1)14-8-11-15-10-6-3-7-13-12(10)16-11/h3,6-7,9,14H,1-2,4-5,8H2.
What are the key properties of N-([1,3]thiazolo[5,4-b]pyridin-2-ylmethyl)cyclopentanamine?
N-([1,3]thiazolo[5,4-b]pyridin-2-ylmethyl)cyclopentanamine has a molecular weight of 233.34 g/mol, XLogP of 2.72, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-([1,3]thiazolo[5,4-b]pyridin-2-ylmethyl)cyclopentanamine is sourced from PubChem (CID 65336897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).