C12H25NO3 — CID 65338075
methyl 2-[(3-hydroxy-3-methylbutan-2-yl)amino]-4-methylpentanoate (PubChem CID 65338075) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is methyl 2-[(3-hydroxy-3-methylbutan-2-yl)amino]-4-methylpentanoate.
| Compound Name | methyl 2-[(3-hydroxy-3-methylbutan-2-yl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 65338075 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | methyl 2-[(3-hydroxy-3-methylbutan-2-yl)amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(C)C(C)(C)O |
| InChI | InChI=1S/C12H25NO3/c1-8(2)7-10(11(14)16-6)13-9(3)12(4,5)15/h8-10,13,15H,7H2,1-6H3 |
| InChIKey | WVFFVRSONMICSH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |