C16H21Cl2N3O3 — CID 6534671
ethyl (2Z)-2-[(2,5-dichlorophenyl)hydrazinylidene]-2-(2,6-dimethylmorpholin-4-yl)acetate (PubChem CID 6534671) has the molecular formula C16H21Cl2N3O3 and a molecular weight of 374.27 g/mol. Its IUPAC name is ethyl (2Z)-2-[(2,5-dichlorophenyl)hydrazinylidene]-2-(2,6-dimethylmorpholin-4-yl)acetate.
| Compound Name | ethyl (2Z)-2-[(2,5-dichlorophenyl)hydrazinylidene]-2-(2,6-dimethylmorpholin-4-yl)acetate |
|---|---|
| PubChem CID | 6534671 |
| Molecular Formula | C16H21Cl2N3O3 |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | ethyl (2Z)-2-[(2,5-dichlorophenyl)hydrazinylidene]-2-(2,6-dimethylmorpholin-4-yl)acetate |
| SMILES | CCOC(=O)/C(=N/Nc1cc(Cl)ccc1Cl)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C16H21Cl2N3O3/c1-4-23-16(22)15(21-8-10(2)24-11(3)9-21)20-19-14-7-12(17)5-6-13(14)18/h5-7,10-11,19H,4,8-9H2,1-3H3/b20-15- |
| InChIKey | JCHMFMSWRWHRFI-HKWRFOASSA-N |
| XLogP | 3.39 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|