C15H16N2O2S — CID 65351619
2-(2,3-dihydro-1,4-benzodioxin-3-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine (PubChem CID 65351619) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
|---|---|
| PubChem CID | 65351619 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
| SMILES | NC1CCCc2nc(C3COc4ccccc4O3)sc21 |
| InChI | InChI=1S/C15H16N2O2S/c16-9-4-3-5-10-14(9)20-15(17-10)13-8-18-11-6-1-2-7-12(11)19-13/h1-2,6-7,9,13H,3-5,8,16H2 |
| InChIKey | UXLUJWJYCBJLSL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |