C10H17N3O2 — CID 65352255
1-(1,4-dioxan-2-yl)-2-(1-methylpyrazol-4-yl)ethanamine (PubChem CID 65352255) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-yl)-2-(1-methylpyrazol-4-yl)ethanamine.
| Compound Name | 1-(1,4-dioxan-2-yl)-2-(1-methylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 65352255 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 1-(1,4-dioxan-2-yl)-2-(1-methylpyrazol-4-yl)ethanamine |
| SMILES | Cn1cc(CC(N)C2COCCO2)cn1 |
| InChI | InChI=1S/C10H17N3O2/c1-13-6-8(5-12-13)4-9(11)10-7-14-2-3-15-10/h5-6,9-10H,2-4,7,11H2,1H3 |
| InChIKey | AKGYXSBJTAKOGA-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |