About 1-(2-amino-5-ethyl-4-propylthiophen-3-yl)-2,2-dimethylpropan-1-one
1-(2-amino-5-ethyl-4-propylthiophen-3-yl)-2,2-dimethylpropan-1-one (PubChem CID 65354690) has the molecular formula C14H23NOS
and a molecular weight of 253.41 g/mol. Its IUPAC name is 1-(2-amino-5-ethyl-4-propylthiophen-3-yl)-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-(2-amino-5-ethyl-4-propylthiophen-3-yl)-2,2-dimethylpropan-1-one |
| PubChem CID | 65354690 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 1-(2-amino-5-ethyl-4-propylthiophen-3-yl)-2,2-dimethylpropan-1-one |
| SMILES | CCCc1c(CC)sc(N)c1C(=O)C(C)(C)C |
| InChI | InChI=1S/C14H23NOS/c1-6-8-9-10(7-2)17-13(15)11(9)12(16)14(3,4)5/h6-8,15H2,1-5H3 |
| InChIKey | ICYGNMANPWMJIR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-amino-5-ethyl-4-propylthiophen-3-yl)-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-5-ethyl-4-propylthiophen-3-yl)-2,2-dimethylpropan-1-one?
The IUPAC name of 1-(2-amino-5-ethyl-4-propylthiophen-3-yl)-2,2-dimethylpropan-1-one (CID 65354690) is 1-(2-amino-5-ethyl-4-propylthiophen-3-yl)-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-(2-amino-5-ethyl-4-propylthiophen-3-yl)-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-(2-amino-5-ethyl-4-propylthiophen-3-yl)-2,2-dimethylpropan-1-one is CCCc1c(CC)sc(N)c1C(=O)C(C)(C)C.
What is the InChIKey of 1-(2-amino-5-ethyl-4-propylthiophen-3-yl)-2,2-dimethylpropan-1-one?
The InChIKey is ICYGNMANPWMJIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NOS/c1-6-8-9-10(7-2)17-13(15)11(9)12(16)14(3,4)5/h6-8,15H2,1-5H3.
What are the key properties of 1-(2-amino-5-ethyl-4-propylthiophen-3-yl)-2,2-dimethylpropan-1-one?
1-(2-amino-5-ethyl-4-propylthiophen-3-yl)-2,2-dimethylpropan-1-one has a molecular weight of 253.41 g/mol, XLogP of 4.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-5-ethyl-4-propylthiophen-3-yl)-2,2-dimethylpropan-1-one is sourced from PubChem (CID 65354690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).