C14H22N4O2 — CID 163415268
2,2-dimethyl-1-(2,3,4,6-tetraamino-5-propanoylphenyl)propan-1-one (PubChem CID 163415268) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2,2-dimethyl-1-(2,3,4,6-tetraamino-5-propanoylphenyl)propan-1-one.
| Compound Name | 2,2-dimethyl-1-(2,3,4,6-tetraamino-5-propanoylphenyl)propan-1-one |
|---|---|
| PubChem CID | 163415268 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2,2-dimethyl-1-(2,3,4,6-tetraamino-5-propanoylphenyl)propan-1-one |
| SMILES | CCC(=O)c1c(N)c(N)c(N)c(C(=O)C(C)(C)C)c1N |
| InChI | InChI=1S/C14H22N4O2/c1-5-6(19)7-9(15)8(13(20)14(2,3)4)11(17)12(18)10(7)16/h5,15-18H2,1-4H3 |
| InChIKey | ADVZJDLTLCZCIP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|