C11H14N4 — CID 65363066
2-(3-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 65363066) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-(3-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | 2-(3-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 65363066 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-(3-methylphenyl)-1-(1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | Cc1cccc(CC(N)c2ncn[nH]2)c1 |
| InChI | InChI=1S/C11H14N4/c1-8-3-2-4-9(5-8)6-10(12)11-13-7-14-15-11/h2-5,7,10H,6,12H2,1H3,(H,13,14,15) |
| InChIKey | NDTHXTPIPLBKMZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |