C13H19N3O3S — CID 65366264
4-[[4-(aminomethyl)phenyl]methylsulfonyl]-1,4-diazepan-2-one (PubChem CID 65366264) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-[[4-(aminomethyl)phenyl]methylsulfonyl]-1,4-diazepan-2-one.
| Compound Name | 4-[[4-(aminomethyl)phenyl]methylsulfonyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 65366264 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-[[4-(aminomethyl)phenyl]methylsulfonyl]-1,4-diazepan-2-one |
| SMILES | NCc1ccc(CS(=O)(=O)N2CCCNC(=O)C2)cc1 |
| InChI | InChI=1S/C13H19N3O3S/c14-8-11-2-4-12(5-3-11)10-20(18,19)16-7-1-6-15-13(17)9-16/h2-5H,1,6-10,14H2,(H,15,17) |
| InChIKey | RPADGEQYJSZDJZ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |