C13H16BrFN2O3S — CID 65373226
2-bromo-4-fluoro-5-(2-methylpiperidine-1-carbonyl)benzenesulfonamide (PubChem CID 65373226) has the molecular formula C13H16BrFN2O3S and a molecular weight of 379.25 g/mol. Its IUPAC name is 2-bromo-4-fluoro-5-(2-methylpiperidine-1-carbonyl)benzenesulfonamide.
| Compound Name | 2-bromo-4-fluoro-5-(2-methylpiperidine-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 65373226 |
| Molecular Formula | C13H16BrFN2O3S |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | 2-bromo-4-fluoro-5-(2-methylpiperidine-1-carbonyl)benzenesulfonamide |
| SMILES | CC1CCCCN1C(=O)c1cc(S(N)(=O)=O)c(Br)cc1F |
| InChI | InChI=1S/C13H16BrFN2O3S/c1-8-4-2-3-5-17(8)13(18)9-6-12(21(16,19)20)10(14)7-11(9)15/h6-8H,2-5H2,1H3,(H2,16,19,20) |
| InChIKey | HMKZZZMFCVQHMM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |