C9H10N2O5S — CID 65375407
7-sulfamoyl-2,3-dihydro-1,4-benzodioxine-5-carboxamide (PubChem CID 65375407) has the molecular formula C9H10N2O5S and a molecular weight of 258.25 g/mol. Its IUPAC name is 7-sulfamoyl-2,3-dihydro-1,4-benzodioxine-5-carboxamide.
| Compound Name | 7-sulfamoyl-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
|---|---|
| PubChem CID | 65375407 |
| Molecular Formula | C9H10N2O5S |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 7-sulfamoyl-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
| SMILES | NC(=O)c1cc(S(N)(=O)=O)cc2c1OCCO2 |
| InChI | InChI=1S/C9H10N2O5S/c10-9(12)6-3-5(17(11,13)14)4-7-8(6)16-2-1-15-7/h3-4H,1-2H2,(H2,10,12)(H2,11,13,14) |
| InChIKey | CRBGHZSRZPMAIQ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |