About (E)-1-N,1-N,3-N,3-N-tetramethylbut-1-ene-1,3-diamine
(E)-1-N,1-N,3-N,3-N-tetramethylbut-1-ene-1,3-diamine (PubChem CID 6537975) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is (E)-1-N,1-N,3-N,3-N-tetramethylbut-1-ene-1,3-diamine.
Analyze (E)-1-N,1-N,3-N,3-N-tetramethylbut-1-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-N,1-N,3-N,3-N-tetramethylbut-1-ene-1,3-diamine?
The IUPAC name of (E)-1-N,1-N,3-N,3-N-tetramethylbut-1-ene-1,3-diamine (CID 6537975) is (E)-1-N,1-N,3-N,3-N-tetramethylbut-1-ene-1,3-diamine.
What is the SMILES notation for (E)-1-N,1-N,3-N,3-N-tetramethylbut-1-ene-1,3-diamine?
The canonical SMILES for (E)-1-N,1-N,3-N,3-N-tetramethylbut-1-ene-1,3-diamine is CC(/C=C/N(C)C)N(C)C.
What is the InChIKey of (E)-1-N,1-N,3-N,3-N-tetramethylbut-1-ene-1,3-diamine?
The InChIKey is DOJGJJJBWVDGTJ-VOTSOKGWSA-N. The full InChI is InChI=1S/C8H18N2/c1-8(10(4)5)6-7-9(2)3/h6-8H,1-5H3/b7-6+.
What are the key properties of (E)-1-N,1-N,3-N,3-N-tetramethylbut-1-ene-1,3-diamine?
(E)-1-N,1-N,3-N,3-N-tetramethylbut-1-ene-1,3-diamine has a molecular weight of 142.25 g/mol, XLogP of 1.01, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-N,1-N,3-N,3-N-tetramethylbut-1-ene-1,3-diamine is sourced from PubChem (CID 6537975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).