C12H17NO6S — CID 65380892
oxan-4-ylmethyl 5-methyl-4-sulfamoylfuran-2-carboxylate (PubChem CID 65380892) has the molecular formula C12H17NO6S and a molecular weight of 303.34 g/mol. Its IUPAC name is oxan-4-ylmethyl 5-methyl-4-sulfamoylfuran-2-carboxylate.
| Compound Name | oxan-4-ylmethyl 5-methyl-4-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 65380892 |
| Molecular Formula | C12H17NO6S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | oxan-4-ylmethyl 5-methyl-4-sulfamoylfuran-2-carboxylate |
| SMILES | Cc1oc(C(=O)OCC2CCOCC2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H17NO6S/c1-8-11(20(13,15)16)6-10(19-8)12(14)18-7-9-2-4-17-5-3-9/h6,9H,2-5,7H2,1H3,(H2,13,15,16) |
| InChIKey | DSPVYBYEERYLRB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |