C14H21NO5S — CID 114342786
(4,4-dimethylcyclohexyl) 5-methyl-4-sulfamoylfuran-2-carboxylate (PubChem CID 114342786) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is (4,4-dimethylcyclohexyl) 5-methyl-4-sulfamoylfuran-2-carboxylate.
| Compound Name | (4,4-dimethylcyclohexyl) 5-methyl-4-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 114342786 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (4,4-dimethylcyclohexyl) 5-methyl-4-sulfamoylfuran-2-carboxylate |
| SMILES | Cc1oc(C(=O)OC2CCC(C)(C)CC2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C14H21NO5S/c1-9-12(21(15,17)18)8-11(19-9)13(16)20-10-4-6-14(2,3)7-5-10/h8,10H,4-7H2,1-3H3,(H2,15,17,18) |
| InChIKey | APKYHHJISQZCKG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |