C13H20N2O3S2 — CID 65388638
5-[2-(2,3-dimethylpiperidin-1-yl)-2-oxoethyl]thiophene-2-sulfonamide (PubChem CID 65388638) has the molecular formula C13H20N2O3S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 5-[2-(2,3-dimethylpiperidin-1-yl)-2-oxoethyl]thiophene-2-sulfonamide.
| Compound Name | 5-[2-(2,3-dimethylpiperidin-1-yl)-2-oxoethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 65388638 |
| Molecular Formula | C13H20N2O3S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 5-[2-(2,3-dimethylpiperidin-1-yl)-2-oxoethyl]thiophene-2-sulfonamide |
| SMILES | CC1CCCN(C(=O)Cc2ccc(S(N)(=O)=O)s2)C1C |
| InChI | InChI=1S/C13H20N2O3S2/c1-9-4-3-7-15(10(9)2)12(16)8-11-5-6-13(19-11)20(14,17)18/h5-6,9-10H,3-4,7-8H2,1-2H3,(H2,14,17,18) |
| InChIKey | FYBKYFWSDFZWGC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |