C14H22N4O2 — CID 65389710
3-[(3-cycloheptyl-1,2,4-oxadiazol-5-yl)methyl]piperazin-2-one (PubChem CID 65389710) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 3-[(3-cycloheptyl-1,2,4-oxadiazol-5-yl)methyl]piperazin-2-one.
| Compound Name | 3-[(3-cycloheptyl-1,2,4-oxadiazol-5-yl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 65389710 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 3-[(3-cycloheptyl-1,2,4-oxadiazol-5-yl)methyl]piperazin-2-one |
| SMILES | O=C1NCCNC1Cc1nc(C2CCCCCC2)no1 |
| InChI | InChI=1S/C14H22N4O2/c19-14-11(15-7-8-16-14)9-12-17-13(18-20-12)10-5-3-1-2-4-6-10/h10-11,15H,1-9H2,(H,16,19) |
| InChIKey | MGIDBORRLVAFSG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |