C23H24Cl2N6O2 — CID 6538998
2-(2,5-dichloro-N-[2-[4-[3-(dimethylamino)-2-hydroxypropoxy]anilino]pyrimidin-4-yl]anilino)acetonitrile (PubChem CID 6538998) has the molecular formula C23H24Cl2N6O2 and a molecular weight of 487.39 g/mol. Its IUPAC name is 2-(2,5-dichloro-N-[2-[4-[3-(dimethylamino)-2-hydroxypropoxy]anilino]pyrimidin-4-yl]anilino)acetonitrile.
| Compound Name | 2-(2,5-dichloro-N-[2-[4-[3-(dimethylamino)-2-hydroxypropoxy]anilino]pyrimidin-4-yl]anilino)acetonitrile |
|---|---|
| PubChem CID | 6538998 |
| Molecular Formula | C23H24Cl2N6O2 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 2-(2,5-dichloro-N-[2-[4-[3-(dimethylamino)-2-hydroxypropoxy]anilino]pyrimidin-4-yl]anilino)acetonitrile |
| SMILES | CN(C)CC(O)COc1ccc(Nc2nccc(N(CC#N)c3cc(Cl)ccc3Cl)n2)cc1 |
| InChI | InChI=1S/C23H24Cl2N6O2/c1-30(2)14-18(32)15-33-19-6-4-17(5-7-19)28-23-27-11-9-22(29-23)31(12-10-26)21-13-16(24)3-8-20(21)25/h3-9,11,13,18,32H,12,14-15H2,1-2H3,(H,27,28,29) |
| InChIKey | XOZQJBAUFVCEOP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|