C11H20F3NO2 — CID 65394225
2-(aminomethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-ol (PubChem CID 65394225) has the molecular formula C11H20F3NO2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-(aminomethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-ol.
| Compound Name | 2-(aminomethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 65394225 |
| Molecular Formula | C11H20F3NO2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-(aminomethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-ol |
| SMILES | NCC1(CCOCC(F)(F)F)CCCCC1O |
| InChI | InChI=1S/C11H20F3NO2/c12-11(13,14)8-17-6-5-10(7-15)4-2-1-3-9(10)16/h9,16H,1-8,15H2 |
| InChIKey | RPTHKKSYNXFLHP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|