C13H12N2O2 — CID 65406764
2-(2,3-dihydro-1H-inden-1-yl)-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 65406764) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-1-yl)-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 2-(2,3-dihydro-1H-inden-1-yl)-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 65406764 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-1-yl)-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | O=c1cc(O)nc(C2CCc3ccccc32)[nH]1 |
| InChI | InChI=1S/C13H12N2O2/c16-11-7-12(17)15-13(14-11)10-6-5-8-3-1-2-4-9(8)10/h1-4,7,10H,5-6H2,(H2,14,15,16,17) |
| InChIKey | KFGGGLUZFJJXFA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |