C14H14N2O — CID 65406952
2-(1,2,3,4-tetrahydronaphthalen-2-yl)-1H-pyrimidin-6-one (PubChem CID 65406952) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydronaphthalen-2-yl)-1H-pyrimidin-6-one.
| Compound Name | 2-(1,2,3,4-tetrahydronaphthalen-2-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 65406952 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-(1,2,3,4-tetrahydronaphthalen-2-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(C2CCc3ccccc3C2)[nH]1 |
| InChI | InChI=1S/C14H14N2O/c17-13-7-8-15-14(16-13)12-6-5-10-3-1-2-4-11(10)9-12/h1-4,7-8,12H,5-6,9H2,(H,15,16,17) |
| InChIKey | QIVBVKRUJLHZNM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |