C17H22O — CID 65407814
2,3-dihydro-1H-inden-1-yl-(3-methylcyclohexyl)methanone (PubChem CID 65407814) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-1-yl-(3-methylcyclohexyl)methanone.
| Compound Name | 2,3-dihydro-1H-inden-1-yl-(3-methylcyclohexyl)methanone |
|---|---|
| PubChem CID | 65407814 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 2,3-dihydro-1H-inden-1-yl-(3-methylcyclohexyl)methanone |
| SMILES | CC1CCCC(C(=O)C2CCc3ccccc32)C1 |
| InChI | InChI=1S/C17H22O/c1-12-5-4-7-14(11-12)17(18)16-10-9-13-6-2-3-8-15(13)16/h2-3,6,8,12,14,16H,4-5,7,9-11H2,1H3 |
| InChIKey | KTKPMKWNUPLNBQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |