C19H28O2 — CID 65408549
2-(2-ethylhexyl)-3,4-dihydro-1H-naphthalene-2-carboxylic acid (PubChem CID 65408549) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 2-(2-ethylhexyl)-3,4-dihydro-1H-naphthalene-2-carboxylic acid.
| Compound Name | 2-(2-ethylhexyl)-3,4-dihydro-1H-naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 65408549 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 2-(2-ethylhexyl)-3,4-dihydro-1H-naphthalene-2-carboxylic acid |
| SMILES | CCCCC(CC)CC1(C(=O)O)CCc2ccccc2C1 |
| InChI | InChI=1S/C19H28O2/c1-3-5-8-15(4-2)13-19(18(20)21)12-11-16-9-6-7-10-17(16)14-19/h6-7,9-10,15H,3-5,8,11-14H2,1-2H3,(H,20,21) |
| InChIKey | KTBFGMNLFMHUNF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |