C16H19N3 — CID 65411686
4-[2-amino-2-(2,3-dihydro-1H-inden-2-yl)ethyl]pyridin-2-amine (PubChem CID 65411686) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 4-[2-amino-2-(2,3-dihydro-1H-inden-2-yl)ethyl]pyridin-2-amine.
| Compound Name | 4-[2-amino-2-(2,3-dihydro-1H-inden-2-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 65411686 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 4-[2-amino-2-(2,3-dihydro-1H-inden-2-yl)ethyl]pyridin-2-amine |
| SMILES | Nc1cc(CC(N)C2Cc3ccccc3C2)ccn1 |
| InChI | InChI=1S/C16H19N3/c17-15(7-11-5-6-19-16(18)8-11)14-9-12-3-1-2-4-13(12)10-14/h1-6,8,14-15H,7,9-10,17H2,(H2,18,19) |
| InChIKey | PIVOVVGGFUYKLM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |