About 5-[amino(cyclopropyl)methyl]-1,2,4-oxadiazol-3-amine
5-[amino(cyclopropyl)methyl]-1,2,4-oxadiazol-3-amine (PubChem CID 65416408) has the molecular formula C6H10N4O
and a molecular weight of 154.17 g/mol. Its IUPAC name is 5-[amino(cyclopropyl)methyl]-1,2,4-oxadiazol-3-amine.
Analyze 5-[amino(cyclopropyl)methyl]-1,2,4-oxadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[amino(cyclopropyl)methyl]-1,2,4-oxadiazol-3-amine?
The IUPAC name of 5-[amino(cyclopropyl)methyl]-1,2,4-oxadiazol-3-amine (CID 65416408) is 5-[amino(cyclopropyl)methyl]-1,2,4-oxadiazol-3-amine.
What is the SMILES notation for 5-[amino(cyclopropyl)methyl]-1,2,4-oxadiazol-3-amine?
The canonical SMILES for 5-[amino(cyclopropyl)methyl]-1,2,4-oxadiazol-3-amine is Nc1noc(C(N)C2CC2)n1.
What is the InChIKey of 5-[amino(cyclopropyl)methyl]-1,2,4-oxadiazol-3-amine?
The InChIKey is RKBFWPHFJFBLPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O/c7-4(3-1-2-3)5-9-6(8)10-11-5/h3-4H,1-2,7H2,(H2,8,10).
What are the key properties of 5-[amino(cyclopropyl)methyl]-1,2,4-oxadiazol-3-amine?
5-[amino(cyclopropyl)methyl]-1,2,4-oxadiazol-3-amine has a molecular weight of 154.17 g/mol, XLogP of 0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[amino(cyclopropyl)methyl]-1,2,4-oxadiazol-3-amine is sourced from PubChem (CID 65416408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).