C7H12N6 — CID 130568176
6-[amino(cyclopropyl)methyl]-1,3,5-triazine-2,4-diamine (PubChem CID 130568176) has the molecular formula C7H12N6 and a molecular weight of 180.22 g/mol. Its IUPAC name is 6-[amino(cyclopropyl)methyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[amino(cyclopropyl)methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 130568176 |
| Molecular Formula | C7H12N6 |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 6-[amino(cyclopropyl)methyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(C(N)C2CC2)n1 |
| InChI | InChI=1S/C7H12N6/c8-4(3-1-2-3)5-11-6(9)13-7(10)12-5/h3-4H,1-2,8H2,(H4,9,10,11,12,13) |
| InChIKey | YBCPYUNZQUWARZ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |