C12H14BrFO — CID 65422333
2-(4-bromo-2-fluorophenyl)-1-(2-methylcyclopropyl)ethanol (PubChem CID 65422333) has the molecular formula C12H14BrFO and a molecular weight of 273.14 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-1-(2-methylcyclopropyl)ethanol.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-1-(2-methylcyclopropyl)ethanol |
|---|---|
| PubChem CID | 65422333 |
| Molecular Formula | C12H14BrFO |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-1-(2-methylcyclopropyl)ethanol |
| SMILES | CC1CC1C(O)Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C12H14BrFO/c1-7-4-10(7)12(15)5-8-2-3-9(13)6-11(8)14/h2-3,6-7,10,12,15H,4-5H2,1H3 |
| InChIKey | XLPRELSXTRAJFZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |