C14H18O3 — CID 65428621
1-(5-methoxy-1-benzofuran-2-yl)-2,2-dimethylpropan-1-ol (PubChem CID 65428621) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 1-(5-methoxy-1-benzofuran-2-yl)-2,2-dimethylpropan-1-ol.
| Compound Name | 1-(5-methoxy-1-benzofuran-2-yl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 65428621 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 1-(5-methoxy-1-benzofuran-2-yl)-2,2-dimethylpropan-1-ol |
| SMILES | COc1ccc2oc(C(O)C(C)(C)C)cc2c1 |
| InChI | InChI=1S/C14H18O3/c1-14(2,3)13(15)12-8-9-7-10(16-4)5-6-11(9)17-12/h5-8,13,15H,1-4H3 |
| InChIKey | FFUTXFNQKFWQBA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |