C25H26N6O3S — CID 654294
1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[1-(4-methoxyphenyl)pyrazolo[5,4-d]pyrimidin-4-yl]sulfanylethanone (PubChem CID 654294) has the molecular formula C25H26N6O3S and a molecular weight of 490.59 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[1-(4-methoxyphenyl)pyrazolo[5,4-d]pyrimidin-4-yl]sulfanylethanone.
| Compound Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[1-(4-methoxyphenyl)pyrazolo[5,4-d]pyrimidin-4-yl]sulfanylethanone |
|---|---|
| PubChem CID | 654294 |
| Molecular Formula | C25H26N6O3S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[1-(4-methoxyphenyl)pyrazolo[5,4-d]pyrimidin-4-yl]sulfanylethanone |
| SMILES | COc1ccc(N2CCN(C(=O)CSc3ncnc4c3cnn4-c3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H26N6O3S/c1-33-20-7-3-18(4-8-20)29-11-13-30(14-12-29)23(32)16-35-25-22-15-28-31(24(22)26-17-27-25)19-5-9-21(34-2)10-6-19/h3-10,15,17H,11-14,16H2,1-2H3 |
| InChIKey | QONFECBDIHDYOK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|