C13H9BrN4O3 — CID 65430168
3-(4-bromo-2-nitrophenoxy)-5,6-dimethylpyridazine-4-carbonitrile (PubChem CID 65430168) has the molecular formula C13H9BrN4O3 and a molecular weight of 349.14 g/mol. Its IUPAC name is 3-(4-bromo-2-nitrophenoxy)-5,6-dimethylpyridazine-4-carbonitrile.
| Compound Name | 3-(4-bromo-2-nitrophenoxy)-5,6-dimethylpyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 65430168 |
| Molecular Formula | C13H9BrN4O3 |
| Molecular Weight | 349.14 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 3-(4-bromo-2-nitrophenoxy)-5,6-dimethylpyridazine-4-carbonitrile |
| SMILES | Cc1nnc(Oc2ccc(Br)cc2[N+](=O)[O-])c(C#N)c1C |
| InChI | InChI=1S/C13H9BrN4O3/c1-7-8(2)16-17-13(10(7)6-15)21-12-4-3-9(14)5-11(12)18(19)20/h3-5H,1-2H3 |
| InChIKey | QCEBMHMWUZUVTR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 101.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.14 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|