C16H21NO — CID 65438821
N-[(7-tert-butyl-1-benzofuran-2-yl)methyl]cyclopropanamine (PubChem CID 65438821) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is N-[(7-tert-butyl-1-benzofuran-2-yl)methyl]cyclopropanamine.
| Compound Name | N-[(7-tert-butyl-1-benzofuran-2-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 65438821 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | N-[(7-tert-butyl-1-benzofuran-2-yl)methyl]cyclopropanamine |
| SMILES | CC(C)(C)c1cccc2cc(CNC3CC3)oc12 |
| InChI | InChI=1S/C16H21NO/c1-16(2,3)14-6-4-5-11-9-13(18-15(11)14)10-17-12-7-8-12/h4-6,9,12,17H,7-8,10H2,1-3H3 |
| InChIKey | HBXZJFDRKNDYEB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |