C15H18BrNO — CID 113303052
N-[(5-bromo-7-propan-2-yl-1-benzofuran-2-yl)methyl]cyclopropanamine (PubChem CID 113303052) has the molecular formula C15H18BrNO and a molecular weight of 308.22 g/mol. Its IUPAC name is N-[(5-bromo-7-propan-2-yl-1-benzofuran-2-yl)methyl]cyclopropanamine.
| Compound Name | N-[(5-bromo-7-propan-2-yl-1-benzofuran-2-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 113303052 |
| Molecular Formula | C15H18BrNO |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | N-[(5-bromo-7-propan-2-yl-1-benzofuran-2-yl)methyl]cyclopropanamine |
| SMILES | CC(C)c1cc(Br)cc2cc(CNC3CC3)oc12 |
| InChI | InChI=1S/C15H18BrNO/c1-9(2)14-7-11(16)5-10-6-13(18-15(10)14)8-17-12-3-4-12/h5-7,9,12,17H,3-4,8H2,1-2H3 |
| InChIKey | YZZGTNNNWGSINL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |