C13H15Cl2NO — CID 65439053
1-(5,7-dichloro-1-benzofuran-2-yl)-N-ethylpropan-1-amine (PubChem CID 65439053) has the molecular formula C13H15Cl2NO and a molecular weight of 272.17 g/mol. Its IUPAC name is 1-(5,7-dichloro-1-benzofuran-2-yl)-N-ethylpropan-1-amine.
| Compound Name | 1-(5,7-dichloro-1-benzofuran-2-yl)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 65439053 |
| Molecular Formula | C13H15Cl2NO |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 1-(5,7-dichloro-1-benzofuran-2-yl)-N-ethylpropan-1-amine |
| SMILES | CCNC(CC)c1cc2cc(Cl)cc(Cl)c2o1 |
| InChI | InChI=1S/C13H15Cl2NO/c1-3-11(16-4-2)12-6-8-5-9(14)7-10(15)13(8)17-12/h5-7,11,16H,3-4H2,1-2H3 |
| InChIKey | MJLJDYREWDOMFC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |