C15H18ClNO — CID 65438893
N-[(5-chloro-7-methyl-1-benzofuran-2-yl)-cyclopropylmethyl]ethanamine (PubChem CID 65438893) has the molecular formula C15H18ClNO and a molecular weight of 263.77 g/mol. Its IUPAC name is N-[(5-chloro-7-methyl-1-benzofuran-2-yl)-cyclopropylmethyl]ethanamine.
| Compound Name | N-[(5-chloro-7-methyl-1-benzofuran-2-yl)-cyclopropylmethyl]ethanamine |
|---|---|
| PubChem CID | 65438893 |
| Molecular Formula | C15H18ClNO |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-[(5-chloro-7-methyl-1-benzofuran-2-yl)-cyclopropylmethyl]ethanamine |
| SMILES | CCNC(c1cc2cc(Cl)cc(C)c2o1)C1CC1 |
| InChI | InChI=1S/C15H18ClNO/c1-3-17-14(10-4-5-10)13-8-11-7-12(16)6-9(2)15(11)18-13/h6-8,10,14,17H,3-5H2,1-2H3 |
| InChIKey | BOQJCVCKSIJXCK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |