C11H18O3S — CID 65443506
2-[1-[(2-hydroxycyclopentyl)sulfanylmethyl]cyclopropyl]acetic acid (PubChem CID 65443506) has the molecular formula C11H18O3S and a molecular weight of 230.33 g/mol. Its IUPAC name is 2-[1-[(2-hydroxycyclopentyl)sulfanylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[(2-hydroxycyclopentyl)sulfanylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65443506 |
| Molecular Formula | C11H18O3S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 2-[1-[(2-hydroxycyclopentyl)sulfanylmethyl]cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(CSC2CCCC2O)CC1 |
| InChI | InChI=1S/C11H18O3S/c12-8-2-1-3-9(8)15-7-11(4-5-11)6-10(13)14/h8-9,12H,1-7H2,(H,13,14) |
| InChIKey | NHVUKCBLCHGABR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |