C17H17NO2 — CID 65444542
4-(2,3-dihydro-1-benzofuran-5-yl)-1-pyridin-2-ylbutan-2-one (PubChem CID 65444542) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzofuran-5-yl)-1-pyridin-2-ylbutan-2-one.
| Compound Name | 4-(2,3-dihydro-1-benzofuran-5-yl)-1-pyridin-2-ylbutan-2-one |
|---|---|
| PubChem CID | 65444542 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 4-(2,3-dihydro-1-benzofuran-5-yl)-1-pyridin-2-ylbutan-2-one |
| SMILES | O=C(CCc1ccc2c(c1)CCO2)Cc1ccccn1 |
| InChI | InChI=1S/C17H17NO2/c19-16(12-15-3-1-2-9-18-15)6-4-13-5-7-17-14(11-13)8-10-20-17/h1-3,5,7,9,11H,4,6,8,10,12H2 |
| InChIKey | ZFRDBLCAPUHMSR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |