C18H17ClO2 — CID 65446055
1-(3-chlorophenyl)-4-(2,3-dihydro-1-benzofuran-5-yl)butan-2-one (PubChem CID 65446055) has the molecular formula C18H17ClO2 and a molecular weight of 300.79 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-(2,3-dihydro-1-benzofuran-5-yl)butan-2-one.
| Compound Name | 1-(3-chlorophenyl)-4-(2,3-dihydro-1-benzofuran-5-yl)butan-2-one |
|---|---|
| PubChem CID | 65446055 |
| Molecular Formula | C18H17ClO2 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-(3-chlorophenyl)-4-(2,3-dihydro-1-benzofuran-5-yl)butan-2-one |
| SMILES | O=C(CCc1ccc2c(c1)CCO2)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H17ClO2/c19-16-3-1-2-14(11-16)12-17(20)6-4-13-5-7-18-15(10-13)8-9-21-18/h1-3,5,7,10-11H,4,6,8-9,12H2 |
| InChIKey | KMPRAKJIDCRKJY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |