C16H16O2S — CID 65445169
2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethylsulfanyl]phenol (PubChem CID 65445169) has the molecular formula C16H16O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethylsulfanyl]phenol.
| Compound Name | 2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethylsulfanyl]phenol |
|---|---|
| PubChem CID | 65445169 |
| Molecular Formula | C16H16O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethylsulfanyl]phenol |
| SMILES | Oc1ccccc1SCCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H16O2S/c17-14-3-1-2-4-16(14)19-10-8-12-5-6-15-13(11-12)7-9-18-15/h1-6,11,17H,7-10H2 |
| InChIKey | QHLIWHBAJDOVRV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |